 ProductsFriends links |
|
 Click image to view full size image |
|
| Product: |
Views:200Sodium Tolyltriazole |
| Unit price: |
Negotiable |
| MOQ: |
|
| Quantity: |
|
| Delivery date: |
Since the payment date Days delivery |
| Valid until: |
Long-term effective |
| Last updated: |
2017-10-06 03:40 |
| |
 |
|
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
64665-57-2 |
| EC NO: |
265-004-9 |
| Molecular Formula: |
C7H6N3Na |
| Molecular Weight: |
155.1324 |
| Specification: |
|
| InChI: |
InChI=1/C7H6N3.Na/c1-5-3-2-4-6-7(5)9-10-8-6;/h2-4H,1H3;/q-1;+1 |
| Synonyms: |
SODIUM TOLYLTRIAZOLE;sodium 4-methylbenzotriazol-1-ide;Tolyltriazole sodium salt;TTAS;TTA-S;Sodium Tolyltriazole (TTAS);Sodium Tolyltriazole(TTA-S); |
| Molecular Structure: |
 |
|
E-mail: